C18H21ClN2O4 — CID 119618694
N-(6-amino-1,3-benzodioxol-5-yl)-2-(4-propan-2-ylphenoxy)acetamide;hydrochloride (PubChem CID 119618694) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-2-(4-propan-2-ylphenoxy)acetamide;hydrochloride.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(4-propan-2-ylphenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119618694 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-2-(4-propan-2-ylphenoxy)acetamide;hydrochloride |
| SMILES | CC(C)c1ccc(OCC(=O)Nc2cc3c(cc2N)OCO3)cc1.Cl |
| InChI | InChI=1S/C18H20N2O4.ClH/c1-11(2)12-3-5-13(6-4-12)22-9-18(21)20-15-8-17-16(7-14(15)19)23-10-24-17;/h3-8,11H,9-10,19H2,1-2H3,(H,20,21);1H |
| InChIKey | KKEMHGMFXNWROB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|