C17H18N2O4S — CID 119618427
N-(6-amino-1,3-benzodioxol-5-yl)-4-(2,5-dimethylthiophen-3-yl)-4-oxobutanamide (PubChem CID 119618427) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-4-(2,5-dimethylthiophen-3-yl)-4-oxobutanamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-(2,5-dimethylthiophen-3-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 119618427 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-4-(2,5-dimethylthiophen-3-yl)-4-oxobutanamide |
| SMILES | Cc1cc(C(=O)CCC(=O)Nc2cc3c(cc2N)OCO3)c(C)s1 |
| InChI | InChI=1S/C17H18N2O4S/c1-9-5-11(10(2)24-9)14(20)3-4-17(21)19-13-7-16-15(6-12(13)18)22-8-23-16/h5-7H,3-4,8,18H2,1-2H3,(H,19,21) |
| InChIKey | DFCNNZKDUIDBRY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|