C13H12N2O3S — CID 43548279
N-(6-amino-1,3-benzodioxol-5-yl)-5-methylthiophene-2-carboxamide (PubChem CID 43548279) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-5-methylthiophene-2-carboxamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 43548279 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cc3c(cc2N)OCO3)s1 |
| InChI | InChI=1S/C13H12N2O3S/c1-7-2-3-12(19-7)13(16)15-9-5-11-10(4-8(9)14)17-6-18-11/h2-5H,6,14H2,1H3,(H,15,16) |
| InChIKey | XPZVSWWBFISFMP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|