C12H9ClN2O4 — CID 103807343
N-(6-amino-1,3-benzodioxol-5-yl)-5-chlorofuran-2-carboxamide (PubChem CID 103807343) has the molecular formula C12H9ClN2O4 and a molecular weight of 280.67 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-5-chlorofuran-2-carboxamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-5-chlorofuran-2-carboxamide |
|---|---|
| PubChem CID | 103807343 |
| Molecular Formula | C12H9ClN2O4 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-5-chlorofuran-2-carboxamide |
| SMILES | Nc1cc2c(cc1NC(=O)c1ccc(Cl)o1)OCO2 |
| InChI | InChI=1S/C12H9ClN2O4/c13-11-2-1-8(19-11)12(16)15-7-4-10-9(3-6(7)14)17-5-18-10/h1-4H,5,14H2,(H,15,16) |
| InChIKey | IDDKIDFAHPRIOK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|