C13H12N2O4 — CID 43548190
N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)furan-2-carboxamide (PubChem CID 43548190) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)furan-2-carboxamide.
| Compound Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 43548190 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)furan-2-carboxamide |
| SMILES | Nc1cc2c(cc1NC(=O)c1ccco1)OCCO2 |
| InChI | InChI=1S/C13H12N2O4/c14-8-6-11-12(19-5-4-18-11)7-9(8)15-13(16)10-2-1-3-17-10/h1-3,6-7H,4-5,14H2,(H,15,16) |
| InChIKey | IDCXJYDPQMTOFD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|