C14H13BrN2O4 — CID 43549100
N-(8-amino-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-bromofuran-2-carboxamide (PubChem CID 43549100) has the molecular formula C14H13BrN2O4 and a molecular weight of 353.17 g/mol. Its IUPAC name is N-(8-amino-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-bromofuran-2-carboxamide.
| Compound Name | N-(8-amino-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 43549100 |
| Molecular Formula | C14H13BrN2O4 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | N-(8-amino-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-bromofuran-2-carboxamide |
| SMILES | Nc1cc2c(cc1NC(=O)c1ccc(Br)o1)OCCCO2 |
| InChI | InChI=1S/C14H13BrN2O4/c15-13-3-2-10(21-13)14(18)17-9-7-12-11(6-8(9)16)19-4-1-5-20-12/h2-3,6-7H,1,4-5,16H2,(H,17,18) |
| InChIKey | ANNICINYIWAILE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|