C13H10BrNO3 — CID 34441377
5-bromo-N-(2,3-dihydro-1-benzofuran-5-yl)furan-2-carboxamide (PubChem CID 34441377) has the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. Its IUPAC name is 5-bromo-N-(2,3-dihydro-1-benzofuran-5-yl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(2,3-dihydro-1-benzofuran-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 34441377 |
| Molecular Formula | C13H10BrNO3 |
| Molecular Weight | 308.13 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 5-bromo-N-(2,3-dihydro-1-benzofuran-5-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCO2)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H10BrNO3/c14-12-4-3-11(18-12)13(16)15-9-1-2-10-8(7-9)5-6-17-10/h1-4,7H,5-6H2,(H,15,16) |
| InChIKey | WRNRVXXQGVRNEF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.13 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |