C13H12N2O5S — CID 112522621
N-(2,3-dihydro-1-benzofuran-5-yl)-5-sulfamoylfuran-2-carboxamide (PubChem CID 112522621) has the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-yl)-5-sulfamoylfuran-2-carboxamide.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-yl)-5-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 112522621 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-yl)-5-sulfamoylfuran-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)Nc2ccc3c(c2)CCO3)o1 |
| InChI | InChI=1S/C13H12N2O5S/c14-21(17,18)12-4-3-11(20-12)13(16)15-9-1-2-10-8(7-9)5-6-19-10/h1-4,7H,5-6H2,(H,15,16)(H2,14,17,18) |
| InChIKey | QGOHKKLRRYVRCJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |