C13H12N2O5S — CID 84575705
N-(4-acetylphenyl)-5-sulfamoylfuran-2-carboxamide (PubChem CID 84575705) has the molecular formula C13H12N2O5S and a molecular weight of 308.31 g/mol. Its IUPAC name is N-(4-acetylphenyl)-5-sulfamoylfuran-2-carboxamide.
| Compound Name | N-(4-acetylphenyl)-5-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 84575705 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | N-(4-acetylphenyl)-5-sulfamoylfuran-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc(S(N)(=O)=O)o2)cc1 |
| InChI | InChI=1S/C13H12N2O5S/c1-8(16)9-2-4-10(5-3-9)15-13(17)11-6-7-12(20-11)21(14,18)19/h2-7H,1H3,(H,15,17)(H2,14,18,19) |
| InChIKey | SEUWKDYCUIDVRM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |