C13H11N3O4S2 — CID 112525636
N-(2-methyl-1,3-benzothiazol-5-yl)-5-sulfamoylfuran-2-carboxamide (PubChem CID 112525636) has the molecular formula C13H11N3O4S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzothiazol-5-yl)-5-sulfamoylfuran-2-carboxamide.
| Compound Name | N-(2-methyl-1,3-benzothiazol-5-yl)-5-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 112525636 |
| Molecular Formula | C13H11N3O4S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | N-(2-methyl-1,3-benzothiazol-5-yl)-5-sulfamoylfuran-2-carboxamide |
| SMILES | Cc1nc2cc(NC(=O)c3ccc(S(N)(=O)=O)o3)ccc2s1 |
| InChI | InChI=1S/C13H11N3O4S2/c1-7-15-9-6-8(2-4-11(9)21-7)16-13(17)10-3-5-12(20-10)22(14,18)19/h2-6H,1H3,(H,16,17)(H2,14,18,19) |
| InChIKey | MUKYRKHEMRBJCA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |