C13H10N2OS2 — CID 110442376
N-(2-methyl-1,3-benzothiazol-5-yl)thiophene-2-carboxamide (PubChem CID 110442376) has the molecular formula C13H10N2OS2 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzothiazol-5-yl)thiophene-2-carboxamide.
| Compound Name | N-(2-methyl-1,3-benzothiazol-5-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 110442376 |
| Molecular Formula | C13H10N2OS2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | N-(2-methyl-1,3-benzothiazol-5-yl)thiophene-2-carboxamide |
| SMILES | Cc1nc2cc(NC(=O)c3cccs3)ccc2s1 |
| InChI | InChI=1S/C13H10N2OS2/c1-8-14-10-7-9(4-5-11(10)18-8)15-13(16)12-3-2-6-17-12/h2-7H,1H3,(H,15,16) |
| InChIKey | PATQALCFJMDJNA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |