C15H13N3O2S2 — CID 46328581
N-[2-(propanoylamino)-1,3-benzothiazol-5-yl]thiophene-2-carboxamide (PubChem CID 46328581) has the molecular formula C15H13N3O2S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-[2-(propanoylamino)-1,3-benzothiazol-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[2-(propanoylamino)-1,3-benzothiazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46328581 |
| Molecular Formula | C15H13N3O2S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-[2-(propanoylamino)-1,3-benzothiazol-5-yl]thiophene-2-carboxamide |
| SMILES | CCC(=O)Nc1nc2cc(NC(=O)c3cccs3)ccc2s1 |
| InChI | InChI=1S/C15H13N3O2S2/c1-2-13(19)18-15-17-10-8-9(5-6-11(10)22-15)16-14(20)12-4-3-7-21-12/h3-8H,2H2,1H3,(H,16,20)(H,17,18,19) |
| InChIKey | KYSGCJTXYCLDIQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |