C16H16N2OS2 — CID 53268944
N-(6-tert-butyl-1,3-benzothiazol-2-yl)thiophene-2-carboxamide (PubChem CID 53268944) has the molecular formula C16H16N2OS2 and a molecular weight of 316.45 g/mol. Its IUPAC name is N-(6-tert-butyl-1,3-benzothiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(6-tert-butyl-1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 53268944 |
| Molecular Formula | C16H16N2OS2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-(6-tert-butyl-1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
| SMILES | CC(C)(C)c1ccc2nc(NC(=O)c3cccs3)sc2c1 |
| InChI | InChI=1S/C16H16N2OS2/c1-16(2,3)10-6-7-11-13(9-10)21-15(17-11)18-14(19)12-5-4-8-20-12/h4-9H,1-3H3,(H,17,18,19) |
| InChIKey | UTGVERRFKWTUBD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |