C12H7N3O3S2 — CID 16850445
N-(5-nitro-1,3-benzothiazol-2-yl)thiophene-2-carboxamide (PubChem CID 16850445) has the molecular formula C12H7N3O3S2 and a molecular weight of 305.34 g/mol. Its IUPAC name is N-(5-nitro-1,3-benzothiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(5-nitro-1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16850445 |
| Molecular Formula | C12H7N3O3S2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | N-(5-nitro-1,3-benzothiazol-2-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1nc2cc([N+](=O)[O-])ccc2s1)c1cccs1 |
| InChI | InChI=1S/C12H7N3O3S2/c16-11(10-2-1-5-19-10)14-12-13-8-6-7(15(17)18)3-4-9(8)20-12/h1-6H,(H,13,14,16) |
| InChIKey | PHVLZSUGSTZODD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|