C16H9N3O3S3 — CID 4113948
5-nitro-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1-benzothiophene-2-carboxamide (PubChem CID 4113948) has the molecular formula C16H9N3O3S3 and a molecular weight of 387.47 g/mol. Its IUPAC name is 5-nitro-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-nitro-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4113948 |
| Molecular Formula | C16H9N3O3S3 |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | 5-nitro-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccs2)cs1)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C16H9N3O3S3/c20-15(18-16-17-11(8-24-16)13-2-1-5-23-13)14-7-9-6-10(19(21)22)3-4-12(9)25-14/h1-8H,(H,17,18,20) |
| InChIKey | AXAUVNHNPUHOQY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|