C18H11N3O3S2 — CID 4175471
5-nitro-N-(4-phenyl-1,3-thiazol-2-yl)-1-benzothiophene-2-carboxamide (PubChem CID 4175471) has the molecular formula C18H11N3O3S2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 5-nitro-N-(4-phenyl-1,3-thiazol-2-yl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-nitro-N-(4-phenyl-1,3-thiazol-2-yl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4175471 |
| Molecular Formula | C18H11N3O3S2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 5-nitro-N-(4-phenyl-1,3-thiazol-2-yl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C18H11N3O3S2/c22-17(16-9-12-8-13(21(23)24)6-7-15(12)26-16)20-18-19-14(10-25-18)11-4-2-1-3-5-11/h1-10H,(H,19,20,22) |
| InChIKey | VUOCOMHOHHKOMP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|