C17H11F2N3O4S — CID 112806003
2-(difluoromethoxy)-5-nitro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 112806003) has the molecular formula C17H11F2N3O4S and a molecular weight of 391.36 g/mol. Its IUPAC name is 2-(difluoromethoxy)-5-nitro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-(difluoromethoxy)-5-nitro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 112806003 |
| Molecular Formula | C17H11F2N3O4S |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2-(difluoromethoxy)-5-nitro-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1cc([N+](=O)[O-])ccc1OC(F)F |
| InChI | InChI=1S/C17H11F2N3O4S/c18-16(19)26-14-7-6-11(22(24)25)8-12(14)15(23)21-17-20-13(9-27-17)10-4-2-1-3-5-10/h1-9,16H,(H,20,21,23) |
| InChIKey | HZOMBJBEOWBSHU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|