C15H8ClF2N3O4S — CID 112811856
N-(6-chloro-1,3-benzothiazol-2-yl)-2-(difluoromethoxy)-5-nitrobenzamide (PubChem CID 112811856) has the molecular formula C15H8ClF2N3O4S and a molecular weight of 399.76 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-2-(difluoromethoxy)-5-nitrobenzamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-(difluoromethoxy)-5-nitrobenzamide |
|---|---|
| PubChem CID | 112811856 |
| Molecular Formula | C15H8ClF2N3O4S |
| Molecular Weight | 399.76 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-2-(difluoromethoxy)-5-nitrobenzamide |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)c1cc([N+](=O)[O-])ccc1OC(F)F |
| InChI | InChI=1S/C15H8ClF2N3O4S/c16-7-1-3-10-12(5-7)26-15(19-10)20-13(22)9-6-8(21(23)24)2-4-11(9)25-14(17)18/h1-6,14H,(H,19,20,22) |
| InChIKey | VBJXZPKPTZWTDG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.76 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|