C15H9Cl2N3O4S — CID 4126350
2-(2,4-dichlorophenoxy)-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 4126350) has the molecular formula C15H9Cl2N3O4S and a molecular weight of 398.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4126350 |
| Molecular Formula | C15H9Cl2N3O4S |
| Molecular Weight | 398.23 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C15H9Cl2N3O4S/c16-8-1-4-12(10(17)5-8)24-7-14(21)19-15-18-11-3-2-9(20(22)23)6-13(11)25-15/h1-6H,7H2,(H,18,19,21) |
| InChIKey | NXYVBOYUJZDLEQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.23 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|