C16H9ClN4O3S3 — CID 2162590
2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 2162590) has the molecular formula C16H9ClN4O3S3 and a molecular weight of 436.93 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2162590 |
| Molecular Formula | C16H9ClN4O3S3 |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 435.95 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(6-nitro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | O=C(CSc1nc2cc(Cl)ccc2s1)Nc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C16H9ClN4O3S3/c17-8-1-4-12-11(5-8)19-16(27-12)25-7-14(22)20-15-18-10-3-2-9(21(23)24)6-13(10)26-15/h1-6H,7H2,(H,18,20,22) |
| InChIKey | DICHGNQFIUZPNY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|