C15H9Cl2N3O3S2 — CID 3463949
2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(2-chloro-4-nitrophenyl)acetamide (PubChem CID 3463949) has the molecular formula C15H9Cl2N3O3S2 and a molecular weight of 414.30 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(2-chloro-4-nitrophenyl)acetamide.
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(2-chloro-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3463949 |
| Molecular Formula | C15H9Cl2N3O3S2 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 412.95 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(2-chloro-4-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nc2cc(Cl)ccc2s1)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H9Cl2N3O3S2/c16-8-1-4-13-12(5-8)19-15(25-13)24-7-14(21)18-11-3-2-9(20(22)23)6-10(11)17/h1-6H,7H2,(H,18,21) |
| InChIKey | KFUTXZKBKYLHDJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|