C11H7Cl2N3O4S — CID 3619772
2-(2,4-dichlorophenoxy)-N-(5-nitro-1,3-thiazol-2-yl)acetamide (PubChem CID 3619772) has the molecular formula C11H7Cl2N3O4S and a molecular weight of 348.17 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(5-nitro-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3619772 |
| Molecular Formula | C11H7Cl2N3O4S |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H7Cl2N3O4S/c12-6-1-2-8(7(13)3-6)20-5-9(17)15-11-14-4-10(21-11)16(18)19/h1-4H,5H2,(H,14,15,17) |
| InChIKey | YQQSCASAFGVRTA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|