C9H6Cl2N4O2S — CID 19114260
2-(2,4-dichlorophenoxy)-N-(thiatriazol-5-yl)acetamide (PubChem CID 19114260) has the molecular formula C9H6Cl2N4O2S and a molecular weight of 305.15 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(thiatriazol-5-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(thiatriazol-5-yl)acetamide |
|---|---|
| PubChem CID | 19114260 |
| Molecular Formula | C9H6Cl2N4O2S |
| Molecular Weight | 305.15 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(thiatriazol-5-yl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1nnns1 |
| InChI | InChI=1S/C9H6Cl2N4O2S/c10-5-1-2-7(6(11)3-5)17-4-8(16)12-9-13-14-15-18-9/h1-3H,4H2,(H,12,13,15,16) |
| InChIKey | YOFDOIZYTHUOKS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.15 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |