C10H10N4O2S — CID 19114261
2-(2-methylphenoxy)-N-(thiatriazol-5-yl)acetamide (PubChem CID 19114261) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is 2-(2-methylphenoxy)-N-(thiatriazol-5-yl)acetamide.
| Compound Name | 2-(2-methylphenoxy)-N-(thiatriazol-5-yl)acetamide |
|---|---|
| PubChem CID | 19114261 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-(2-methylphenoxy)-N-(thiatriazol-5-yl)acetamide |
| SMILES | Cc1ccccc1OCC(=O)Nc1nnns1 |
| InChI | InChI=1S/C10H10N4O2S/c1-7-4-2-3-5-8(7)16-6-9(15)11-10-12-13-14-17-10/h2-5H,6H2,1H3,(H,11,12,14,15) |
| InChIKey | SZDCLWQHIKJDCD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |