C9H7FN4O2S — CID 19114256
2-(4-fluorophenoxy)-N-(thiatriazol-5-yl)acetamide (PubChem CID 19114256) has the molecular formula C9H7FN4O2S and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-(thiatriazol-5-yl)acetamide.
| Compound Name | 2-(4-fluorophenoxy)-N-(thiatriazol-5-yl)acetamide |
|---|---|
| PubChem CID | 19114256 |
| Molecular Formula | C9H7FN4O2S |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-(thiatriazol-5-yl)acetamide |
| SMILES | O=C(COc1ccc(F)cc1)Nc1nnns1 |
| InChI | InChI=1S/C9H7FN4O2S/c10-6-1-3-7(4-2-6)16-5-8(15)11-9-12-13-14-17-9/h1-4H,5H2,(H,11,12,14,15) |
| InChIKey | YAMVVDTYRYCUSJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |