C23H17FN2O2S — CID 19178667
N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(4-phenylphenoxy)acetamide (PubChem CID 19178667) has the molecular formula C23H17FN2O2S and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(4-phenylphenoxy)acetamide.
| Compound Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(4-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 19178667 |
| Molecular Formula | C23H17FN2O2S |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(4-phenylphenoxy)acetamide |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)Nc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C23H17FN2O2S/c24-19-10-6-18(7-11-19)21-15-29-23(25-21)26-22(27)14-28-20-12-8-17(9-13-20)16-4-2-1-3-5-16/h1-13,15H,14H2,(H,25,26,27) |
| InChIKey | VANVXMCVQRZWBM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |