C27H26N2O2S — CID 19178615
2-(4-tert-butylphenoxy)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 19178615) has the molecular formula C27H26N2O2S and a molecular weight of 442.58 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 19178615 |
| Molecular Formula | C27H26N2O2S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)Nc2nc(-c3ccc(-c4ccccc4)cc3)cs2)cc1 |
| InChI | InChI=1S/C27H26N2O2S/c1-27(2,3)22-13-15-23(16-14-22)31-17-25(30)29-26-28-24(18-32-26)21-11-9-20(10-12-21)19-7-5-4-6-8-19/h4-16,18H,17H2,1-3H3,(H,28,29,30) |
| InChIKey | KGGDIWRXHOUARD-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |