C21H16N2O2S — CID 3647343
N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2-phenoxyacetamide (PubChem CID 3647343) has the molecular formula C21H16N2O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2-phenoxyacetamide.
| Compound Name | N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 3647343 |
| Molecular Formula | C21H16N2O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C21H16N2O2S/c24-20(13-25-18-8-2-1-3-9-18)23-21-22-19(14-26-21)17-11-10-15-6-4-5-7-16(15)12-17/h1-12,14H,13H2,(H,22,23,24) |
| InChIKey | JBISIQICSHHSSU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |