C17H15N3O2S — CID 28861376
N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-phenoxyacetamide (PubChem CID 28861376) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-phenoxyacetamide.
| Compound Name | N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 28861376 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-2-phenoxyacetamide |
| SMILES | Nc1ccc(-c2csc(NC(=O)COc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H15N3O2S/c18-13-8-6-12(7-9-13)15-11-23-17(19-15)20-16(21)10-22-14-4-2-1-3-5-14/h1-9,11H,10,18H2,(H,19,20,21) |
| InChIKey | BWASMJGTMHRIAZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|