C14H7Cl2N3O5S2 — CID 23742087
[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate (PubChem CID 23742087) has the molecular formula C14H7Cl2N3O5S2 and a molecular weight of 432.27 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 23742087 |
| Molecular Formula | C14H7Cl2N3O5S2 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 430.92 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1sc2cc(Cl)ccc2c1Cl)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H7Cl2N3O5S2/c15-6-1-2-7-8(3-6)25-12(11(7)16)13(21)24-5-9(20)18-14-17-4-10(26-14)19(22)23/h1-4H,5H2,(H,17,18,20) |
| InChIKey | QFIHEGDRKMNNIH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|