C17H10Cl2N2O5S — CID 3879575
[2-(4-nitroanilino)-2-oxoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate (PubChem CID 3879575) has the molecular formula C17H10Cl2N2O5S and a molecular weight of 425.25 g/mol. Its IUPAC name is [2-(4-nitroanilino)-2-oxoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-(4-nitroanilino)-2-oxoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 3879575 |
| Molecular Formula | C17H10Cl2N2O5S |
| Molecular Weight | 425.25 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | [2-(4-nitroanilino)-2-oxoethyl] 3,6-dichloro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1sc2cc(Cl)ccc2c1Cl)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H10Cl2N2O5S/c18-9-1-6-12-13(7-9)27-16(15(12)19)17(23)26-8-14(22)20-10-2-4-11(5-3-10)21(24)25/h1-7H,8H2,(H,20,22) |
| InChIKey | WWBAWWOXJNKJIP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.25 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|