C16H11ClN2O3S — CID 2932756
3-chloro-6-methyl-N-(4-nitrophenyl)-1-benzothiophene-2-carboxamide (PubChem CID 2932756) has the molecular formula C16H11ClN2O3S and a molecular weight of 346.80 g/mol. Its IUPAC name is 3-chloro-6-methyl-N-(4-nitrophenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-methyl-N-(4-nitrophenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2932756 |
| Molecular Formula | C16H11ClN2O3S |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 3-chloro-6-methyl-N-(4-nitrophenyl)-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2c(Cl)c(C(=O)Nc3ccc([N+](=O)[O-])cc3)sc2c1 |
| InChI | InChI=1S/C16H11ClN2O3S/c1-9-2-7-12-13(8-9)23-15(14(12)17)16(20)18-10-3-5-11(6-4-10)19(21)22/h2-8H,1H3,(H,18,20) |
| InChIKey | YQWDGAFGIZWODC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|