C17H13ClN2O3S — CID 1008272
3-chloro-N-(3,4-dimethylphenyl)-6-nitro-1-benzothiophene-2-carboxamide (PubChem CID 1008272) has the molecular formula C17H13ClN2O3S and a molecular weight of 360.82 g/mol. Its IUPAC name is 3-chloro-N-(3,4-dimethylphenyl)-6-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(3,4-dimethylphenyl)-6-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 1008272 |
| Molecular Formula | C17H13ClN2O3S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 3-chloro-N-(3,4-dimethylphenyl)-6-nitro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2sc3cc([N+](=O)[O-])ccc3c2Cl)cc1C |
| InChI | InChI=1S/C17H13ClN2O3S/c1-9-3-4-11(7-10(9)2)19-17(21)16-15(18)13-6-5-12(20(22)23)8-14(13)24-16/h3-8H,1-2H3,(H,19,21) |
| InChIKey | DRWZBDJNDGEOLY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|