C16H10ClFN2O4S — CID 16959985
3-chloro-6-fluoro-N-(2-methoxy-5-nitrophenyl)-1-benzothiophene-2-carboxamide (PubChem CID 16959985) has the molecular formula C16H10ClFN2O4S and a molecular weight of 380.78 g/mol. Its IUPAC name is 3-chloro-6-fluoro-N-(2-methoxy-5-nitrophenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-fluoro-N-(2-methoxy-5-nitrophenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 16959985 |
| Molecular Formula | C16H10ClFN2O4S |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 3-chloro-6-fluoro-N-(2-methoxy-5-nitrophenyl)-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C16H10ClFN2O4S/c1-24-12-5-3-9(20(22)23)7-11(12)19-16(21)15-14(17)10-4-2-8(18)6-13(10)25-15/h2-7H,1H3,(H,19,21) |
| InChIKey | ZEUCPNWZVGCURV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|