C12H8Cl2N2O4S — CID 55374643
2,5-dichloro-N-(2-methoxy-5-nitrophenyl)thiophene-3-carboxamide (PubChem CID 55374643) has the molecular formula C12H8Cl2N2O4S and a molecular weight of 347.18 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-methoxy-5-nitrophenyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(2-methoxy-5-nitrophenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 55374643 |
| Molecular Formula | C12H8Cl2N2O4S |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 2,5-dichloro-N-(2-methoxy-5-nitrophenyl)thiophene-3-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H8Cl2N2O4S/c1-20-9-3-2-6(16(18)19)4-8(9)15-12(17)7-5-10(13)21-11(7)14/h2-5H,1H3,(H,15,17) |
| InChIKey | DWBFKNZCNDIFSU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|