C18H12ClFN2O6S — CID 3626414
[2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 3626414) has the molecular formula C18H12ClFN2O6S and a molecular weight of 438.82 g/mol. Its IUPAC name is [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 3626414 |
| Molecular Formula | C18H12ClFN2O6S |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | [2-(2-methoxy-5-nitroanilino)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)COC(=O)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C18H12ClFN2O6S/c1-27-13-5-3-10(22(25)26)7-12(13)21-15(23)8-28-18(24)17-16(19)11-4-2-9(20)6-14(11)29-17/h2-7H,8H2,1H3,(H,21,23) |
| InChIKey | PORALOLLGGETHR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|