C17H8Cl4FNO3S — CID 4241051
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 4241051) has the molecular formula C17H8Cl4FNO3S and a molecular weight of 467.13 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4241051 |
| Molecular Formula | C17H8Cl4FNO3S |
| Molecular Weight | 467.13 g/mol |
| Exact Mass | 464.90 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1sc2cc(F)ccc2c1Cl)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H8Cl4FNO3S/c18-9-4-11(20)12(5-10(9)19)23-14(24)6-26-17(25)16-15(21)8-2-1-7(22)3-13(8)27-16/h1-5H,6H2,(H,23,24) |
| InChIKey | ZPDMUIGQOHGVGP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.13 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|