C17H9ClF2O3S — CID 8666920
[2-(3-fluorophenyl)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 8666920) has the molecular formula C17H9ClF2O3S and a molecular weight of 366.77 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-(3-fluorophenyl)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8666920 |
| Molecular Formula | C17H9ClF2O3S |
| Molecular Weight | 366.77 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | [2-(3-fluorophenyl)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1sc2cc(F)ccc2c1Cl)c1cccc(F)c1 |
| InChI | InChI=1S/C17H9ClF2O3S/c18-15-12-5-4-11(20)7-14(12)24-16(15)17(22)23-8-13(21)9-2-1-3-10(19)6-9/h1-7H,8H2 |
| InChIKey | KHSQIFZYKKAAHB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.77 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |