C17H10ClFINO3S — CID 4590844
[2-(4-iodoanilino)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 4590844) has the molecular formula C17H10ClFINO3S and a molecular weight of 489.69 g/mol. Its IUPAC name is [2-(4-iodoanilino)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-(4-iodoanilino)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4590844 |
| Molecular Formula | C17H10ClFINO3S |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 488.91 |
| IUPAC Name | [2-(4-iodoanilino)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1sc2cc(F)ccc2c1Cl)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C17H10ClFINO3S/c18-15-12-6-1-9(19)7-13(12)25-16(15)17(23)24-8-14(22)21-11-4-2-10(20)3-5-11/h1-7H,8H2,(H,21,22) |
| InChIKey | BHKDNXVXGDFYRQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|