C18H13ClFNO4S — CID 4858749
[2-(4-methoxyanilino)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 4858749) has the molecular formula C18H13ClFNO4S and a molecular weight of 393.82 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4858749 |
| Molecular Formula | C18H13ClFNO4S |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2sc3cc(F)ccc3c2Cl)cc1 |
| InChI | InChI=1S/C18H13ClFNO4S/c1-24-12-5-3-11(4-6-12)21-15(22)9-25-18(23)17-16(19)13-7-2-10(20)8-14(13)26-17/h2-8H,9H2,1H3,(H,21,22) |
| InChIKey | HYNUVCOOXITADD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |