C22H15ClFN3O3S — CID 24530456
[3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate (PubChem CID 24530456) has the molecular formula C22H15ClFN3O3S and a molecular weight of 455.90 g/mol. Its IUPAC name is [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate.
| Compound Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 24530456 |
| Molecular Formula | C22H15ClFN3O3S |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | [3-cyano-3-(1,3-dimethylbenzimidazol-2-ylidene)-2-oxopropyl] 3-chloro-6-fluoro-1-benzothiophene-2-carboxylate |
| SMILES | CN1C(=C(C#N)C(=O)COC(=O)c2sc3cc(F)ccc3c2Cl)N(C)c2ccccc21 |
| InChI | InChI=1S/C22H15ClFN3O3S/c1-26-15-5-3-4-6-16(15)27(2)21(26)14(10-25)17(28)11-30-22(29)20-19(23)13-8-7-12(24)9-18(13)31-20/h3-9H,11H2,1-2H3 |
| InChIKey | TUJXZDWSUROSCL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|