C17H11ClFNO3S — CID 993999
methyl 3-[(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)amino]benzoate (PubChem CID 993999) has the molecular formula C17H11ClFNO3S and a molecular weight of 363.80 g/mol. Its IUPAC name is methyl 3-[(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)amino]benzoate.
| Compound Name | methyl 3-[(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 993999 |
| Molecular Formula | C17H11ClFNO3S |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | methyl 3-[(3-chloro-6-fluoro-1-benzothiophene-2-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2sc3cc(F)ccc3c2Cl)c1 |
| InChI | InChI=1S/C17H11ClFNO3S/c1-23-17(22)9-3-2-4-11(7-9)20-16(21)15-14(18)12-6-5-10(19)8-13(12)24-15/h2-8H,1H3,(H,20,21) |
| InChIKey | QEZVPGYBHBCPDO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |