C15H8BrClFNOS — CID 26914051
N-(3-bromophenyl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 26914051) has the molecular formula C15H8BrClFNOS and a molecular weight of 384.66 g/mol. Its IUPAC name is N-(3-bromophenyl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(3-bromophenyl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 26914051 |
| Molecular Formula | C15H8BrClFNOS |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | N-(3-bromophenyl)-3-chloro-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C15H8BrClFNOS/c16-8-2-1-3-10(6-8)19-15(20)14-13(17)11-5-4-9(18)7-12(11)21-14/h1-7H,(H,19,20) |
| InChIKey | XYINCVLFQNTYQL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |