C20H17ClFNO3S2 — CID 39209798
3-chloro-N-(3-cyclopentylsulfonylphenyl)-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 39209798) has the molecular formula C20H17ClFNO3S2 and a molecular weight of 437.95 g/mol. Its IUPAC name is 3-chloro-N-(3-cyclopentylsulfonylphenyl)-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(3-cyclopentylsulfonylphenyl)-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 39209798 |
| Molecular Formula | C20H17ClFNO3S2 |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 3-chloro-N-(3-cyclopentylsulfonylphenyl)-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)C2CCCC2)c1)c1sc2cc(F)ccc2c1Cl |
| InChI | InChI=1S/C20H17ClFNO3S2/c21-18-16-9-8-12(22)10-17(16)27-19(18)20(24)23-13-4-3-7-15(11-13)28(25,26)14-5-1-2-6-14/h3-4,7-11,14H,1-2,5-6H2,(H,23,24) |
| InChIKey | KAHJGKYPOWJEOO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |