C17H17FN2O3S — CID 155781142
N-(3-cyclopentylsulfonylphenyl)-2-fluoropyridine-3-carboxamide (PubChem CID 155781142) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(3-cyclopentylsulfonylphenyl)-2-fluoropyridine-3-carboxamide.
| Compound Name | N-(3-cyclopentylsulfonylphenyl)-2-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 155781142 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-(3-cyclopentylsulfonylphenyl)-2-fluoropyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)C2CCCC2)c1)c1cccnc1F |
| InChI | InChI=1S/C17H17FN2O3S/c18-16-15(9-4-10-19-16)17(21)20-12-5-3-8-14(11-12)24(22,23)13-6-1-2-7-13/h3-5,8-11,13H,1-2,6-7H2,(H,20,21) |
| InChIKey | OHHVSULWRNXIEP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|