C19H19N3O3S2 — CID 55852070
N-(3-cyclopentylsulfonylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 55852070) has the molecular formula C19H19N3O3S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-(3-cyclopentylsulfonylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(3-cyclopentylsulfonylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55852070 |
| Molecular Formula | C19H19N3O3S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-(3-cyclopentylsulfonylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)C2CCCC2)c1)c1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C19H19N3O3S2/c23-19(17-12-16(21-22-17)18-9-4-10-26-18)20-13-5-3-8-15(11-13)27(24,25)14-6-1-2-7-14/h3-5,8-12,14H,1-2,6-7H2,(H,20,23)(H,21,22) |
| InChIKey | MUGWBILVWMKVNH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |