C20H20N4O3S — CID 47026452
N-(3-cyclopentylsulfonylphenyl)-2-phenyltriazole-4-carboxamide (PubChem CID 47026452) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-(3-cyclopentylsulfonylphenyl)-2-phenyltriazole-4-carboxamide.
| Compound Name | N-(3-cyclopentylsulfonylphenyl)-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 47026452 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-(3-cyclopentylsulfonylphenyl)-2-phenyltriazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)C2CCCC2)c1)c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H20N4O3S/c25-20(19-14-21-24(23-19)16-8-2-1-3-9-16)22-15-7-6-12-18(13-15)28(26,27)17-10-4-5-11-17/h1-3,6-9,12-14,17H,4-5,10-11H2,(H,22,25) |
| InChIKey | INGLYPWKNPAEEL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |