C22H22ClN3O3S — CID 55612679
1-[(2-chlorophenyl)methyl]-N-(3-cyclopentylsulfonylphenyl)pyrazole-4-carboxamide (PubChem CID 55612679) has the molecular formula C22H22ClN3O3S and a molecular weight of 443.96 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-(3-cyclopentylsulfonylphenyl)pyrazole-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-(3-cyclopentylsulfonylphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55612679 |
| Molecular Formula | C22H22ClN3O3S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-(3-cyclopentylsulfonylphenyl)pyrazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)C2CCCC2)c1)c1cnn(Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H22ClN3O3S/c23-21-11-4-1-6-16(21)14-26-15-17(13-24-26)22(27)25-18-7-5-10-20(12-18)30(28,29)19-8-2-3-9-19/h1,4-7,10-13,15,19H,2-3,8-9,14H2,(H,25,27) |
| InChIKey | KJVGDCQWXARYJV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |