C22H22ClN5O3S — CID 60557805
1-[(2-chlorophenyl)methyl]-N-[4-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]pyrazole-4-carboxamide (PubChem CID 60557805) has the molecular formula C22H22ClN5O3S and a molecular weight of 471.97 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[4-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]pyrazole-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[4-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60557805 |
| Molecular Formula | C22H22ClN5O3S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[4-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]pyrazole-4-carboxamide |
| SMILES | CN1CCC/C1=N\S(=O)(=O)c1ccc(NC(=O)c2cnn(Cc3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C22H22ClN5O3S/c1-27-12-4-7-21(27)26-32(30,31)19-10-8-18(9-11-19)25-22(29)17-13-24-28(15-17)14-16-5-2-3-6-20(16)23/h2-3,5-6,8-11,13,15H,4,7,12,14H2,1H3,(H,25,29)/b26-21+ |
| InChIKey | NIDBDCJXGBIDFP-YYADALCUSA-N |
| XLogP | 3.65 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|