C20H23ClN4O4S — CID 55882356
5-chloro-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-6-propan-2-yloxypyridine-3-carboxamide (PubChem CID 55882356) has the molecular formula C20H23ClN4O4S and a molecular weight of 450.95 g/mol. Its IUPAC name is 5-chloro-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-6-propan-2-yloxypyridine-3-carboxamide.
| Compound Name | 5-chloro-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-6-propan-2-yloxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 55882356 |
| Molecular Formula | C20H23ClN4O4S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 5-chloro-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-6-propan-2-yloxypyridine-3-carboxamide |
| SMILES | CC(C)Oc1ncc(C(=O)Nc2ccc(S(=O)(=O)N=C3CCCN3C)cc2)cc1Cl |
| InChI | InChI=1S/C20H23ClN4O4S/c1-13(2)29-20-17(21)11-14(12-22-20)19(26)23-15-6-8-16(9-7-15)30(27,28)24-18-5-4-10-25(18)3/h6-9,11-13H,4-5,10H2,1-3H3,(H,23,26) |
| InChIKey | VWLZDXCKAAQKFS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|